C9H18N2O3 — CID 114829312
1-amino-3-ethoxy-N-hydroxy-2,2-dimethylcyclobutane-1-carboxamide (PubChem CID 114829312) has the molecular formula C9H18N2O3 and a molecular weight of 202.25 g/mol. Its IUPAC name is 1-amino-3-ethoxy-N-hydroxy-2,2-dimethylcyclobutane-1-carboxamide.
| Compound Name | 1-amino-3-ethoxy-N-hydroxy-2,2-dimethylcyclobutane-1-carboxamide |
|---|---|
| PubChem CID | 114829312 |
| Molecular Formula | C9H18N2O3 |
| Molecular Weight | 202.25 g/mol |
| Exact Mass | 202.13 |
| IUPAC Name | 1-amino-3-ethoxy-N-hydroxy-2,2-dimethylcyclobutane-1-carboxamide |
| SMILES | CCOC1CC(N)(C(=O)NO)C1(C)C |
| InChI | InChI=1S/C9H18N2O3/c1-4-14-6-5-9(10,7(12)11-13)8(6,2)3/h6,13H,4-5,10H2,1-3H3,(H,11,12) |
| InChIKey | SZOFOPJAGFDBEB-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.25 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|