About 1-amino-3-ethoxy-2,2-dimethyl-N-[(5-oxopyrrolidin-2-yl)methyl]cyclobutane-1-carboxamide
1-amino-3-ethoxy-2,2-dimethyl-N-[(5-oxopyrrolidin-2-yl)methyl]cyclobutane-1-carboxamide (PubChem CID 114829352) has the molecular formula C14H25N3O3
and a molecular weight of 283.37 g/mol. Its IUPAC name is 1-amino-3-ethoxy-2,2-dimethyl-N-[(5-oxopyrrolidin-2-yl)methyl]cyclobutane-1-carboxamide.
Molecular Properties
| Compound Name | 1-amino-3-ethoxy-2,2-dimethyl-N-[(5-oxopyrrolidin-2-yl)methyl]cyclobutane-1-carboxamide |
| PubChem CID | 114829352 |
| Molecular Formula | C14H25N3O3 |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.19 |
| IUPAC Name | 1-amino-3-ethoxy-2,2-dimethyl-N-[(5-oxopyrrolidin-2-yl)methyl]cyclobutane-1-carboxamide |
| SMILES | CCOC1CC(N)(C(=O)NCC2CCC(=O)N2)C1(C)C |
| InChI | InChI=1S/C14H25N3O3/c1-4-20-10-7-14(15,13(10,2)3)12(19)16-8-9-5-6-11(18)17-9/h9-10H,4-8,15H2,1-3H3,(H,16,19)(H,17,18) |
| InChIKey | DHFTUPDPJYMCFS-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-amino-3-ethoxy-2,2-dimethyl-N-[(5-oxopyrrolidin-2-yl)methyl]cyclobutane-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-amino-3-ethoxy-2,2-dimethyl-N-[(5-oxopyrrolidin-2-yl)methyl]cyclobutane-1-carboxamide?
The IUPAC name of 1-amino-3-ethoxy-2,2-dimethyl-N-[(5-oxopyrrolidin-2-yl)methyl]cyclobutane-1-carboxamide (CID 114829352) is 1-amino-3-ethoxy-2,2-dimethyl-N-[(5-oxopyrrolidin-2-yl)methyl]cyclobutane-1-carboxamide.
What is the SMILES notation for 1-amino-3-ethoxy-2,2-dimethyl-N-[(5-oxopyrrolidin-2-yl)methyl]cyclobutane-1-carboxamide?
The canonical SMILES for 1-amino-3-ethoxy-2,2-dimethyl-N-[(5-oxopyrrolidin-2-yl)methyl]cyclobutane-1-carboxamide is CCOC1CC(N)(C(=O)NCC2CCC(=O)N2)C1(C)C.
What is the InChIKey of 1-amino-3-ethoxy-2,2-dimethyl-N-[(5-oxopyrrolidin-2-yl)methyl]cyclobutane-1-carboxamide?
The InChIKey is DHFTUPDPJYMCFS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H25N3O3/c1-4-20-10-7-14(15,13(10,2)3)12(19)16-8-9-5-6-11(18)17-9/h9-10H,4-8,15H2,1-3H3,(H,16,19)(H,17,18).
What are the key properties of 1-amino-3-ethoxy-2,2-dimethyl-N-[(5-oxopyrrolidin-2-yl)methyl]cyclobutane-1-carboxamide?
1-amino-3-ethoxy-2,2-dimethyl-N-[(5-oxopyrrolidin-2-yl)methyl]cyclobutane-1-carboxamide has a molecular weight of 283.37 g/mol, XLogP of -0.09, 5 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-amino-3-ethoxy-2,2-dimethyl-N-[(5-oxopyrrolidin-2-yl)methyl]cyclobutane-1-carboxamide is sourced from PubChem (CID 114829352), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).