C13H23F3N2O2 — CID 114829739
1-amino-3-ethoxy-2,2-dimethyl-N-(4,4,4-trifluorobutyl)cyclobutane-1-carboxamide (PubChem CID 114829739) has the molecular formula C13H23F3N2O2 and a molecular weight of 296.33 g/mol. Its IUPAC name is 1-amino-3-ethoxy-2,2-dimethyl-N-(4,4,4-trifluorobutyl)cyclobutane-1-carboxamide.
| Compound Name | 1-amino-3-ethoxy-2,2-dimethyl-N-(4,4,4-trifluorobutyl)cyclobutane-1-carboxamide |
|---|---|
| PubChem CID | 114829739 |
| Molecular Formula | C13H23F3N2O2 |
| Molecular Weight | 296.33 g/mol |
| Exact Mass | 296.17 |
| IUPAC Name | 1-amino-3-ethoxy-2,2-dimethyl-N-(4,4,4-trifluorobutyl)cyclobutane-1-carboxamide |
| SMILES | CCOC1CC(N)(C(=O)NCCCC(F)(F)F)C1(C)C |
| InChI | InChI=1S/C13H23F3N2O2/c1-4-20-9-8-12(17,11(9,2)3)10(19)18-7-5-6-13(14,15)16/h9H,4-8,17H2,1-3H3,(H,18,19) |
| InChIKey | FIASSNVBKFHEAP-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.33 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|