C14H25F3N2O2 — CID 114829741
1-amino-3-ethoxy-2,2-dimethyl-N-(5,5,5-trifluoropentyl)cyclobutane-1-carboxamide (PubChem CID 114829741) has the molecular formula C14H25F3N2O2 and a molecular weight of 310.36 g/mol. Its IUPAC name is 1-amino-3-ethoxy-2,2-dimethyl-N-(5,5,5-trifluoropentyl)cyclobutane-1-carboxamide.
| Compound Name | 1-amino-3-ethoxy-2,2-dimethyl-N-(5,5,5-trifluoropentyl)cyclobutane-1-carboxamide |
|---|---|
| PubChem CID | 114829741 |
| Molecular Formula | C14H25F3N2O2 |
| Molecular Weight | 310.36 g/mol |
| Exact Mass | 310.19 |
| IUPAC Name | 1-amino-3-ethoxy-2,2-dimethyl-N-(5,5,5-trifluoropentyl)cyclobutane-1-carboxamide |
| SMILES | CCOC1CC(N)(C(=O)NCCCCC(F)(F)F)C1(C)C |
| InChI | InChI=1S/C14H25F3N2O2/c1-4-21-10-9-13(18,12(10,2)3)11(20)19-8-6-5-7-14(15,16)17/h10H,4-9,18H2,1-3H3,(H,19,20) |
| InChIKey | ZDFUTQLWRFUVPE-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.36 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|