About N-[(1-amino-3-ethoxy-2,2-dimethylcyclobutyl)methyl]-N-methylcycloheptanamine
N-[(1-amino-3-ethoxy-2,2-dimethylcyclobutyl)methyl]-N-methylcycloheptanamine (PubChem CID 114830305) has the molecular formula C17H34N2O
and a molecular weight of 282.47 g/mol. Its IUPAC name is N-[(1-amino-3-ethoxy-2,2-dimethylcyclobutyl)methyl]-N-methylcycloheptanamine.
Molecular Properties
| Compound Name | N-[(1-amino-3-ethoxy-2,2-dimethylcyclobutyl)methyl]-N-methylcycloheptanamine |
| PubChem CID | 114830305 |
| Molecular Formula | C17H34N2O |
| Molecular Weight | 282.47 g/mol |
| Exact Mass | 282.27 |
| IUPAC Name | N-[(1-amino-3-ethoxy-2,2-dimethylcyclobutyl)methyl]-N-methylcycloheptanamine |
| SMILES | CCOC1CC(N)(CN(C)C2CCCCCC2)C1(C)C |
| InChI | InChI=1S/C17H34N2O/c1-5-20-15-12-17(18,16(15,2)3)13-19(4)14-10-8-6-7-9-11-14/h14-15H,5-13,18H2,1-4H3 |
| InChIKey | ARFSHBYHIRCAQN-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.47 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[(1-amino-3-ethoxy-2,2-dimethylcyclobutyl)methyl]-N-methylcycloheptanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1-amino-3-ethoxy-2,2-dimethylcyclobutyl)methyl]-N-methylcycloheptanamine?
The IUPAC name of N-[(1-amino-3-ethoxy-2,2-dimethylcyclobutyl)methyl]-N-methylcycloheptanamine (CID 114830305) is N-[(1-amino-3-ethoxy-2,2-dimethylcyclobutyl)methyl]-N-methylcycloheptanamine.
What is the SMILES notation for N-[(1-amino-3-ethoxy-2,2-dimethylcyclobutyl)methyl]-N-methylcycloheptanamine?
The canonical SMILES for N-[(1-amino-3-ethoxy-2,2-dimethylcyclobutyl)methyl]-N-methylcycloheptanamine is CCOC1CC(N)(CN(C)C2CCCCCC2)C1(C)C.
What is the InChIKey of N-[(1-amino-3-ethoxy-2,2-dimethylcyclobutyl)methyl]-N-methylcycloheptanamine?
The InChIKey is ARFSHBYHIRCAQN-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H34N2O/c1-5-20-15-12-17(18,16(15,2)3)13-19(4)14-10-8-6-7-9-11-14/h14-15H,5-13,18H2,1-4H3.
What are the key properties of N-[(1-amino-3-ethoxy-2,2-dimethylcyclobutyl)methyl]-N-methylcycloheptanamine?
N-[(1-amino-3-ethoxy-2,2-dimethylcyclobutyl)methyl]-N-methylcycloheptanamine has a molecular weight of 282.47 g/mol, XLogP of 3.17, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1-amino-3-ethoxy-2,2-dimethylcyclobutyl)methyl]-N-methylcycloheptanamine is sourced from PubChem (CID 114830305), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).