C15H27O3P — CID 11483047
(6E)-6-(diethoxyphosphorylmethylidene)deca-1,2-diene (PubChem CID 11483047) has the molecular formula C15H27O3P and a molecular weight of 286.35 g/mol. Its IUPAC name is (6E)-6-(diethoxyphosphorylmethylidene)deca-1,2-diene.
| Compound Name | (6E)-6-(diethoxyphosphorylmethylidene)deca-1,2-diene |
|---|---|
| PubChem CID | 11483047 |
| Molecular Formula | C15H27O3P |
| Molecular Weight | 286.35 g/mol |
| Exact Mass | 286.17 |
| IUPAC Name | (6E)-6-(diethoxyphosphorylmethylidene)deca-1,2-diene |
| SMILES | C=C=CCC/C(=C/P(=O)(OCC)OCC)CCCC |
| InChI | InChI=1S/C15H27O3P/c1-5-9-11-13-15(12-10-6-2)14-19(16,17-7-3)18-8-4/h9,14H,1,6-8,10-13H2,2-4H3/b15-14+ |
| InChIKey | VTRDXEUMKUTIJX-CCEZHUSRSA-N |
| XLogP | 5.45 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.35 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|