C12H23F3N2O — CID 114830575
3-ethoxy-2,2-dimethyl-1-[(3,3,3-trifluoropropylamino)methyl]cyclobutan-1-amine (PubChem CID 114830575) has the molecular formula C12H23F3N2O and a molecular weight of 268.32 g/mol. Its IUPAC name is 3-ethoxy-2,2-dimethyl-1-[(3,3,3-trifluoropropylamino)methyl]cyclobutan-1-amine.
| Compound Name | 3-ethoxy-2,2-dimethyl-1-[(3,3,3-trifluoropropylamino)methyl]cyclobutan-1-amine |
|---|---|
| PubChem CID | 114830575 |
| Molecular Formula | C12H23F3N2O |
| Molecular Weight | 268.32 g/mol |
| Exact Mass | 268.18 |
| IUPAC Name | 3-ethoxy-2,2-dimethyl-1-[(3,3,3-trifluoropropylamino)methyl]cyclobutan-1-amine |
| SMILES | CCOC1CC(N)(CNCCC(F)(F)F)C1(C)C |
| InChI | InChI=1S/C12H23F3N2O/c1-4-18-9-7-11(16,10(9,2)3)8-17-6-5-12(13,14)15/h9,17H,4-8,16H2,1-3H3 |
| InChIKey | LMPXHTZYRAKBSZ-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.32 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|