C15H13ClF3N — CID 114830635
2-chloro-4,6-difluoro-N-[1-(3-fluorophenyl)propan-2-yl]aniline (PubChem CID 114830635) has the molecular formula C15H13ClF3N and a molecular weight of 299.72 g/mol. Its IUPAC name is 2-chloro-4,6-difluoro-N-[1-(3-fluorophenyl)propan-2-yl]aniline.
| Compound Name | 2-chloro-4,6-difluoro-N-[1-(3-fluorophenyl)propan-2-yl]aniline |
|---|---|
| PubChem CID | 114830635 |
| Molecular Formula | C15H13ClF3N |
| Molecular Weight | 299.72 g/mol |
| Exact Mass | 299.07 |
| IUPAC Name | 2-chloro-4,6-difluoro-N-[1-(3-fluorophenyl)propan-2-yl]aniline |
| SMILES | CC(Cc1cccc(F)c1)Nc1c(F)cc(F)cc1Cl |
| InChI | InChI=1S/C15H13ClF3N/c1-9(5-10-3-2-4-11(17)6-10)20-15-13(16)7-12(18)8-14(15)19/h2-4,6-9,20H,5H2,1H3 |
| InChIKey | OQCSWCWAIBORKC-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.72 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |