C25H28N6O — CID 1148307
3-[(R)-(1-benzyltetrazol-5-yl)-piperidin-1-ylmethyl]-6-ethyl-1H-quinolin-2-one (PubChem CID 1148307) has the molecular formula C25H28N6O and a molecular weight of 428.54 g/mol. Its IUPAC name is 3-[(R)-(1-benzyltetrazol-5-yl)-piperidin-1-ylmethyl]-6-ethyl-1H-quinolin-2-one.
| Compound Name | 3-[(R)-(1-benzyltetrazol-5-yl)-piperidin-1-ylmethyl]-6-ethyl-1H-quinolin-2-one |
|---|---|
| PubChem CID | 1148307 |
| Molecular Formula | C25H28N6O |
| Molecular Weight | 428.54 g/mol |
| Exact Mass | 428.23 |
| IUPAC Name | 3-[(R)-(1-benzyltetrazol-5-yl)-piperidin-1-ylmethyl]-6-ethyl-1H-quinolin-2-one |
| SMILES | CCc1ccc2[nH]c(=O)c([C@H](c3nnnn3Cc3ccccc3)N3CCCCC3)cc2c1 |
| InChI | InChI=1S/C25H28N6O/c1-2-18-11-12-22-20(15-18)16-21(25(32)26-22)23(30-13-7-4-8-14-30)24-27-28-29-31(24)17-19-9-5-3-6-10-19/h3,5-6,9-12,15-16,23H,2,4,7-8,13-14,17H2,1H3,(H,26,32)/t23-/m1/s1 |
| InChIKey | KPQCOZBFKUIKQO-HSZRJFAPSA-N |
| XLogP | 3.70 |
| TPSA | 79.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.54 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |