About 3-(2-fluorophenyl)-2-N,2-dimethyl-2-N-(1-thiophen-2-ylethyl)propane-1,2-diamine
3-(2-fluorophenyl)-2-N,2-dimethyl-2-N-(1-thiophen-2-ylethyl)propane-1,2-diamine (PubChem CID 114831247) has the molecular formula C17H23FN2S
and a molecular weight of 306.45 g/mol. Its IUPAC name is 3-(2-fluorophenyl)-2-N,2-dimethyl-2-N-(1-thiophen-2-ylethyl)propane-1,2-diamine.
Molecular Properties
| Compound Name | 3-(2-fluorophenyl)-2-N,2-dimethyl-2-N-(1-thiophen-2-ylethyl)propane-1,2-diamine |
| PubChem CID | 114831247 |
| Molecular Formula | C17H23FN2S |
| Molecular Weight | 306.45 g/mol |
| Exact Mass | 306.16 |
| IUPAC Name | 3-(2-fluorophenyl)-2-N,2-dimethyl-2-N-(1-thiophen-2-ylethyl)propane-1,2-diamine |
| SMILES | CC(c1cccs1)N(C)C(C)(CN)Cc1ccccc1F |
| InChI | InChI=1S/C17H23FN2S/c1-13(16-9-6-10-21-16)20(3)17(2,12-19)11-14-7-4-5-8-15(14)18/h4-10,13H,11-12,19H2,1-3H3 |
| InChIKey | GZCVSICBDRDVQV-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.45 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(2-fluorophenyl)-2-N,2-dimethyl-2-N-(1-thiophen-2-ylethyl)propane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-fluorophenyl)-2-N,2-dimethyl-2-N-(1-thiophen-2-ylethyl)propane-1,2-diamine?
The IUPAC name of 3-(2-fluorophenyl)-2-N,2-dimethyl-2-N-(1-thiophen-2-ylethyl)propane-1,2-diamine (CID 114831247) is 3-(2-fluorophenyl)-2-N,2-dimethyl-2-N-(1-thiophen-2-ylethyl)propane-1,2-diamine.
What is the SMILES notation for 3-(2-fluorophenyl)-2-N,2-dimethyl-2-N-(1-thiophen-2-ylethyl)propane-1,2-diamine?
The canonical SMILES for 3-(2-fluorophenyl)-2-N,2-dimethyl-2-N-(1-thiophen-2-ylethyl)propane-1,2-diamine is CC(c1cccs1)N(C)C(C)(CN)Cc1ccccc1F.
What is the InChIKey of 3-(2-fluorophenyl)-2-N,2-dimethyl-2-N-(1-thiophen-2-ylethyl)propane-1,2-diamine?
The InChIKey is GZCVSICBDRDVQV-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H23FN2S/c1-13(16-9-6-10-21-16)20(3)17(2,12-19)11-14-7-4-5-8-15(14)18/h4-10,13H,11-12,19H2,1-3H3.
What are the key properties of 3-(2-fluorophenyl)-2-N,2-dimethyl-2-N-(1-thiophen-2-ylethyl)propane-1,2-diamine?
3-(2-fluorophenyl)-2-N,2-dimethyl-2-N-(1-thiophen-2-ylethyl)propane-1,2-diamine has a molecular weight of 306.45 g/mol, XLogP of 3.84, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-fluorophenyl)-2-N,2-dimethyl-2-N-(1-thiophen-2-ylethyl)propane-1,2-diamine is sourced from PubChem (CID 114831247), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).