About 6,7-dibromo-2H-pyrrolo[1,2-a]pyrazin-1-one
6,7-dibromo-2H-pyrrolo[1,2-a]pyrazin-1-one (PubChem CID 11483192) has the molecular formula C7H4Br2N2O
and a molecular weight of 291.93 g/mol. Its IUPAC name is 6,7-dibromo-2H-pyrrolo[1,2-a]pyrazin-1-one.
Molecular Properties
| Compound Name | 6,7-dibromo-2H-pyrrolo[1,2-a]pyrazin-1-one |
| PubChem CID | 11483192 |
| Molecular Formula | C7H4Br2N2O |
| Molecular Weight | 291.93 g/mol |
| Exact Mass | 289.87 |
| IUPAC Name | 6,7-dibromo-2H-pyrrolo[1,2-a]pyrazin-1-one |
| SMILES | O=c1[nH]ccn2c(Br)c(Br)cc12 |
| InChI | InChI=1S/C7H4Br2N2O/c8-4-3-5-7(12)10-1-2-11(5)6(4)9/h1-3H,(H,10,12) |
| InChIKey | DVJXLGFDWSCHKZ-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 37.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.93 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6,7-dibromo-2H-pyrrolo[1,2-a]pyrazin-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,7-dibromo-2H-pyrrolo[1,2-a]pyrazin-1-one?
The IUPAC name of 6,7-dibromo-2H-pyrrolo[1,2-a]pyrazin-1-one (CID 11483192) is 6,7-dibromo-2H-pyrrolo[1,2-a]pyrazin-1-one.
What is the SMILES notation for 6,7-dibromo-2H-pyrrolo[1,2-a]pyrazin-1-one?
The canonical SMILES for 6,7-dibromo-2H-pyrrolo[1,2-a]pyrazin-1-one is O=c1[nH]ccn2c(Br)c(Br)cc12.
What is the InChIKey of 6,7-dibromo-2H-pyrrolo[1,2-a]pyrazin-1-one?
The InChIKey is DVJXLGFDWSCHKZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4Br2N2O/c8-4-3-5-7(12)10-1-2-11(5)6(4)9/h1-3H,(H,10,12).
What are the key properties of 6,7-dibromo-2H-pyrrolo[1,2-a]pyrazin-1-one?
6,7-dibromo-2H-pyrrolo[1,2-a]pyrazin-1-one has a molecular weight of 291.93 g/mol, XLogP of 2.15, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6,7-dibromo-2H-pyrrolo[1,2-a]pyrazin-1-one is sourced from PubChem (CID 11483192), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).