C14H20FN3O — CID 114831921
3-(2-fluorophenyl)-2-methyl-2-piperazin-1-ylpropanamide (PubChem CID 114831921) has the molecular formula C14H20FN3O and a molecular weight of 265.33 g/mol. Its IUPAC name is 3-(2-fluorophenyl)-2-methyl-2-piperazin-1-ylpropanamide.
| Compound Name | 3-(2-fluorophenyl)-2-methyl-2-piperazin-1-ylpropanamide |
|---|---|
| PubChem CID | 114831921 |
| Molecular Formula | C14H20FN3O |
| Molecular Weight | 265.33 g/mol |
| Exact Mass | 265.16 |
| IUPAC Name | 3-(2-fluorophenyl)-2-methyl-2-piperazin-1-ylpropanamide |
| SMILES | CC(Cc1ccccc1F)(C(N)=O)N1CCNCC1 |
| InChI | InChI=1S/C14H20FN3O/c1-14(13(16)19,18-8-6-17-7-9-18)10-11-4-2-3-5-12(11)15/h2-5,17H,6-10H2,1H3,(H2,16,19) |
| InChIKey | ZIJHJHJPPWGUNM-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.33 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |