C15H21FN2O2 — CID 114832067
2-(1,4-diazepan-1-yl)-3-(4-fluorophenyl)-2-methylpropanoic acid (PubChem CID 114832067) has the molecular formula C15H21FN2O2 and a molecular weight of 280.34 g/mol. Its IUPAC name is 2-(1,4-diazepan-1-yl)-3-(4-fluorophenyl)-2-methylpropanoic acid.
| Compound Name | 2-(1,4-diazepan-1-yl)-3-(4-fluorophenyl)-2-methylpropanoic acid |
|---|---|
| PubChem CID | 114832067 |
| Molecular Formula | C15H21FN2O2 |
| Molecular Weight | 280.34 g/mol |
| Exact Mass | 280.16 |
| IUPAC Name | 2-(1,4-diazepan-1-yl)-3-(4-fluorophenyl)-2-methylpropanoic acid |
| SMILES | CC(Cc1ccc(F)cc1)(C(=O)O)N1CCCNCC1 |
| InChI | InChI=1S/C15H21FN2O2/c1-15(14(19)20,18-9-2-7-17-8-10-18)11-12-3-5-13(16)6-4-12/h3-6,17H,2,7-11H2,1H3,(H,19,20) |
| InChIKey | AKVLKVZLLJIBIQ-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.34 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |