C13H14FNO2 — CID 114832162
3-(3-fluorophenyl)-2-methyl-2-(prop-2-ynylamino)propanoic acid (PubChem CID 114832162) has the molecular formula C13H14FNO2 and a molecular weight of 235.26 g/mol. Its IUPAC name is 3-(3-fluorophenyl)-2-methyl-2-(prop-2-ynylamino)propanoic acid.
| Compound Name | 3-(3-fluorophenyl)-2-methyl-2-(prop-2-ynylamino)propanoic acid |
|---|---|
| PubChem CID | 114832162 |
| Molecular Formula | C13H14FNO2 |
| Molecular Weight | 235.26 g/mol |
| Exact Mass | 235.10 |
| IUPAC Name | 3-(3-fluorophenyl)-2-methyl-2-(prop-2-ynylamino)propanoic acid |
| SMILES | C#CCNC(C)(Cc1cccc(F)c1)C(=O)O |
| InChI | InChI=1S/C13H14FNO2/c1-3-7-15-13(2,12(16)17)9-10-5-4-6-11(14)8-10/h1,4-6,8,15H,7,9H2,2H3,(H,16,17) |
| InChIKey | DVIQDTMOVGUEKP-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.26 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|