C19H22N2O — CID 11483266
(2E)-2-[(3R,5S)-3-phenylspiro[2,3,6,7,8,8a-hexahydro-[1,3]oxazolo[3,2-a]pyridine-5,2'-cyclopentane]-1'-ylidene]acetonitrile (PubChem CID 11483266) has the molecular formula C19H22N2O and a molecular weight of 294.40 g/mol. Its IUPAC name is (2E)-2-[(3R,5S)-3-phenylspiro[2,3,6,7,8,8a-hexahydro-[1,3]oxazolo[3,2-a]pyridine-5,2'-cyclopentane]-1'-ylidene]acetonitrile.
| Compound Name | (2E)-2-[(3R,5S)-3-phenylspiro[2,3,6,7,8,8a-hexahydro-[1,3]oxazolo[3,2-a]pyridine-5,2'-cyclopentane]-1'-ylidene]acetonitrile |
|---|---|
| PubChem CID | 11483266 |
| Molecular Formula | C19H22N2O |
| Molecular Weight | 294.40 g/mol |
| Exact Mass | 294.17 |
| IUPAC Name | (2E)-2-[(3R,5S)-3-phenylspiro[2,3,6,7,8,8a-hexahydro-[1,3]oxazolo[3,2-a]pyridine-5,2'-cyclopentane]-1'-ylidene]acetonitrile |
| SMILES | N#C/C=C1\CCC[C@]12CCCC1OC[C@@H](c3ccccc3)N12 |
| InChI | InChI=1S/C19H22N2O/c20-13-10-16-8-4-11-19(16)12-5-9-18-21(19)17(14-22-18)15-6-2-1-3-7-15/h1-3,6-7,10,17-18H,4-5,8-9,11-12,14H2/b16-10+/t17-,18?,19-/m0/s1 |
| InChIKey | MNYJPUPWYGLTGP-BIXKRHHZSA-N |
| XLogP | 3.94 |
| TPSA | 36.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.40 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|