C17H25FO — CID 114833051
2-(3,4-dimethylcyclohexyl)-1-(4-fluorophenyl)propan-2-ol (PubChem CID 114833051) has the molecular formula C17H25FO and a molecular weight of 264.38 g/mol. Its IUPAC name is 2-(3,4-dimethylcyclohexyl)-1-(4-fluorophenyl)propan-2-ol.
| Compound Name | 2-(3,4-dimethylcyclohexyl)-1-(4-fluorophenyl)propan-2-ol |
|---|---|
| PubChem CID | 114833051 |
| Molecular Formula | C17H25FO |
| Molecular Weight | 264.38 g/mol |
| Exact Mass | 264.19 |
| IUPAC Name | 2-(3,4-dimethylcyclohexyl)-1-(4-fluorophenyl)propan-2-ol |
| SMILES | CC1CCC(C(C)(O)Cc2ccc(F)cc2)CC1C |
| InChI | InChI=1S/C17H25FO/c1-12-4-7-15(10-13(12)2)17(3,19)11-14-5-8-16(18)9-6-14/h5-6,8-9,12-13,15,19H,4,7,10-11H2,1-3H3 |
| InChIKey | FWAOOOCMLNTIQR-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.38 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |