C12H15FO — CID 114833422
1-(3-fluorophenyl)-2,3-dimethylbut-3-en-2-ol (PubChem CID 114833422) has the molecular formula C12H15FO and a molecular weight of 194.25 g/mol. Its IUPAC name is 1-(3-fluorophenyl)-2,3-dimethylbut-3-en-2-ol.
| Compound Name | 1-(3-fluorophenyl)-2,3-dimethylbut-3-en-2-ol |
|---|---|
| PubChem CID | 114833422 |
| Molecular Formula | C12H15FO |
| Molecular Weight | 194.25 g/mol |
| Exact Mass | 194.11 |
| IUPAC Name | 1-(3-fluorophenyl)-2,3-dimethylbut-3-en-2-ol |
| SMILES | C=C(C)C(C)(O)Cc1cccc(F)c1 |
| InChI | InChI=1S/C12H15FO/c1-9(2)12(3,14)8-10-5-4-6-11(13)7-10/h4-7,14H,1,8H2,2-3H3 |
| InChIKey | SJMSFROJEJGXPT-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.25 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|