C15H14Cl2FN — CID 114833591
2-(2,3-dichlorophenyl)-1-(2-fluorophenyl)propan-2-amine (PubChem CID 114833591) has the molecular formula C15H14Cl2FN and a molecular weight of 298.19 g/mol. Its IUPAC name is 2-(2,3-dichlorophenyl)-1-(2-fluorophenyl)propan-2-amine.
| Compound Name | 2-(2,3-dichlorophenyl)-1-(2-fluorophenyl)propan-2-amine |
|---|---|
| PubChem CID | 114833591 |
| Molecular Formula | C15H14Cl2FN |
| Molecular Weight | 298.19 g/mol |
| Exact Mass | 297.05 |
| IUPAC Name | 2-(2,3-dichlorophenyl)-1-(2-fluorophenyl)propan-2-amine |
| SMILES | CC(N)(Cc1ccccc1F)c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C15H14Cl2FN/c1-15(19,9-10-5-2-3-8-13(10)18)11-6-4-7-12(16)14(11)17/h2-8H,9,19H2,1H3 |
| InChIKey | RFSNNXLKZWGEST-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.19 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |