C17H20FN — CID 114833811
2-(2,4-dimethylphenyl)-1-(4-fluorophenyl)propan-2-amine (PubChem CID 114833811) has the molecular formula C17H20FN and a molecular weight of 257.35 g/mol. Its IUPAC name is 2-(2,4-dimethylphenyl)-1-(4-fluorophenyl)propan-2-amine.
| Compound Name | 2-(2,4-dimethylphenyl)-1-(4-fluorophenyl)propan-2-amine |
|---|---|
| PubChem CID | 114833811 |
| Molecular Formula | C17H20FN |
| Molecular Weight | 257.35 g/mol |
| Exact Mass | 257.16 |
| IUPAC Name | 2-(2,4-dimethylphenyl)-1-(4-fluorophenyl)propan-2-amine |
| SMILES | Cc1ccc(C(C)(N)Cc2ccc(F)cc2)c(C)c1 |
| InChI | InChI=1S/C17H20FN/c1-12-4-9-16(13(2)10-12)17(3,19)11-14-5-7-15(18)8-6-14/h4-10H,11,19H2,1-3H3 |
| InChIKey | ZIXAZVLZRSRGBW-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.35 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |