C16H22FNO2 — CID 114834840
3-[1-[1-(2-fluorophenyl)propan-2-yl]pyrrolidin-3-yl]propanoic acid (PubChem CID 114834840) has the molecular formula C16H22FNO2 and a molecular weight of 279.35 g/mol. Its IUPAC name is 3-[1-[1-(2-fluorophenyl)propan-2-yl]pyrrolidin-3-yl]propanoic acid.
| Compound Name | 3-[1-[1-(2-fluorophenyl)propan-2-yl]pyrrolidin-3-yl]propanoic acid |
|---|---|
| PubChem CID | 114834840 |
| Molecular Formula | C16H22FNO2 |
| Molecular Weight | 279.35 g/mol |
| Exact Mass | 279.16 |
| IUPAC Name | 3-[1-[1-(2-fluorophenyl)propan-2-yl]pyrrolidin-3-yl]propanoic acid |
| SMILES | CC(Cc1ccccc1F)N1CCC(CCC(=O)O)C1 |
| InChI | InChI=1S/C16H22FNO2/c1-12(10-14-4-2-3-5-15(14)17)18-9-8-13(11-18)6-7-16(19)20/h2-5,12-13H,6-11H2,1H3,(H,19,20) |
| InChIKey | NJMJOLPJFHVNAD-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.35 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |