C16H22FNO2 — CID 114834843
2-ethyl-1-[1-(2-fluorophenyl)propan-2-yl]pyrrolidine-2-carboxylic acid (PubChem CID 114834843) has the molecular formula C16H22FNO2 and a molecular weight of 279.35 g/mol. Its IUPAC name is 2-ethyl-1-[1-(2-fluorophenyl)propan-2-yl]pyrrolidine-2-carboxylic acid.
| Compound Name | 2-ethyl-1-[1-(2-fluorophenyl)propan-2-yl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 114834843 |
| Molecular Formula | C16H22FNO2 |
| Molecular Weight | 279.35 g/mol |
| Exact Mass | 279.16 |
| IUPAC Name | 2-ethyl-1-[1-(2-fluorophenyl)propan-2-yl]pyrrolidine-2-carboxylic acid |
| SMILES | CCC1(C(=O)O)CCCN1C(C)Cc1ccccc1F |
| InChI | InChI=1S/C16H22FNO2/c1-3-16(15(19)20)9-6-10-18(16)12(2)11-13-7-4-5-8-14(13)17/h4-5,7-8,12H,3,6,9-11H2,1-2H3,(H,19,20) |
| InChIKey | WOMXPWVCQNVOGZ-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.35 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |