C15H30O4Si — CID 11483489
(1R,2R,6R)-1-(3-hydroxypropyl)-6-triethylsilyloxycyclohex-3-ene-1,2-diol (PubChem CID 11483489) has the molecular formula C15H30O4Si and a molecular weight of 302.49 g/mol. Its IUPAC name is (1R,2R,6R)-1-(3-hydroxypropyl)-6-triethylsilyloxycyclohex-3-ene-1,2-diol.
| Compound Name | (1R,2R,6R)-1-(3-hydroxypropyl)-6-triethylsilyloxycyclohex-3-ene-1,2-diol |
|---|---|
| PubChem CID | 11483489 |
| Molecular Formula | C15H30O4Si |
| Molecular Weight | 302.49 g/mol |
| Exact Mass | 302.19 |
| IUPAC Name | (1R,2R,6R)-1-(3-hydroxypropyl)-6-triethylsilyloxycyclohex-3-ene-1,2-diol |
| SMILES | CC[Si](CC)(CC)O[C@@H]1CC=C[C@@H](O)[C@]1(O)CCCO |
| InChI | InChI=1S/C15H30O4Si/c1-4-20(5-2,6-3)19-14-10-7-9-13(17)15(14,18)11-8-12-16/h7,9,13-14,16-18H,4-6,8,10-12H2,1-3H3/t13-,14-,15-/m1/s1 |
| InChIKey | BEQYPUAHXGDYHS-RBSFLKMASA-N |
| XLogP | 2.20 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.49 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|