C13H15FO3 — CID 114834899
methyl 3-[(4-fluorophenyl)methyl]-2,3-dimethyloxirane-2-carboxylate (PubChem CID 114834899) has the molecular formula C13H15FO3 and a molecular weight of 238.26 g/mol. Its IUPAC name is methyl 3-[(4-fluorophenyl)methyl]-2,3-dimethyloxirane-2-carboxylate.
| Compound Name | methyl 3-[(4-fluorophenyl)methyl]-2,3-dimethyloxirane-2-carboxylate |
|---|---|
| PubChem CID | 114834899 |
| Molecular Formula | C13H15FO3 |
| Molecular Weight | 238.26 g/mol |
| Exact Mass | 238.10 |
| IUPAC Name | methyl 3-[(4-fluorophenyl)methyl]-2,3-dimethyloxirane-2-carboxylate |
| SMILES | COC(=O)C1(C)OC1(C)Cc1ccc(F)cc1 |
| InChI | InChI=1S/C13H15FO3/c1-12(13(2,17-12)11(15)16-3)8-9-4-6-10(14)7-5-9/h4-7H,8H2,1-3H3 |
| InChIKey | ASYLYCDGXIOVCX-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.26 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|