C11H14INO — CID 11483497
N-(2-iodophenyl)-N,2-dimethylpropanamide (PubChem CID 11483497) has the molecular formula C11H14INO and a molecular weight of 303.14 g/mol. Its IUPAC name is N-(2-iodophenyl)-N,2-dimethylpropanamide.
| Compound Name | N-(2-iodophenyl)-N,2-dimethylpropanamide |
|---|---|
| PubChem CID | 11483497 |
| Molecular Formula | C11H14INO |
| Molecular Weight | 303.14 g/mol |
| Exact Mass | 303.01 |
| IUPAC Name | N-(2-iodophenyl)-N,2-dimethylpropanamide |
| SMILES | CC(C)C(=O)N(C)c1ccccc1I |
| InChI | InChI=1S/C11H14INO/c1-8(2)11(14)13(3)10-7-5-4-6-9(10)12/h4-8H,1-3H3 |
| InChIKey | MAIXZXRBQWIFID-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.14 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|