C24H16 — CID 11483532
5,6,11,12-tetraethynyltricyclo[8.2.2.24,7]hexadeca-1(12),4,6,10,13,15-hexaene (PubChem CID 11483532) has the molecular formula C24H16 and a molecular weight of 304.39 g/mol. Its IUPAC name is 5,6,11,12-tetraethynyltricyclo[8.2.2.24,7]hexadeca-1(12),4,6,10,13,15-hexaene.
| Compound Name | 5,6,11,12-tetraethynyltricyclo[8.2.2.24,7]hexadeca-1(12),4,6,10,13,15-hexaene |
|---|---|
| PubChem CID | 11483532 |
| Molecular Formula | C24H16 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.13 |
| IUPAC Name | 5,6,11,12-tetraethynyltricyclo[8.2.2.24,7]hexadeca-1(12),4,6,10,13,15-hexaene |
| SMILES | C#Cc1c2ccc(c1C#C)CCc1ccc(c(C#C)c1C#C)CC2 |
| InChI | InChI=1S/C24H16/c1-5-21-17-9-10-18(22(21)6-2)15-16-20-12-11-19(14-13-17)23(7-3)24(20)8-4/h1-4,9-12H,13-16H2 |
| InChIKey | CVPIJRGDGSDMMX-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|