C16H19NO5 — CID 11483554
2-[(2S,3R)-2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-4-oxo-3-phenoxyazetidin-1-yl]acetaldehyde (PubChem CID 11483554) has the molecular formula C16H19NO5 and a molecular weight of 305.33 g/mol. Its IUPAC name is 2-[(2S,3R)-2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-4-oxo-3-phenoxyazetidin-1-yl]acetaldehyde.
| Compound Name | 2-[(2S,3R)-2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-4-oxo-3-phenoxyazetidin-1-yl]acetaldehyde |
|---|---|
| PubChem CID | 11483554 |
| Molecular Formula | C16H19NO5 |
| Molecular Weight | 305.33 g/mol |
| Exact Mass | 305.13 |
| IUPAC Name | 2-[(2S,3R)-2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-4-oxo-3-phenoxyazetidin-1-yl]acetaldehyde |
| SMILES | CC1(C)OC[C@H]([C@H]2[C@@H](Oc3ccccc3)C(=O)N2CC=O)O1 |
| InChI | InChI=1S/C16H19NO5/c1-16(2)20-10-12(22-16)13-14(15(19)17(13)8-9-18)21-11-6-4-3-5-7-11/h3-7,9,12-14H,8,10H2,1-2H3/t12-,13+,14-/m1/s1 |
| InChIKey | GMDNGOWIVHGPCH-HZSPNIEDSA-N |
| XLogP | 1.00 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.33 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|