C11H9BrClN3 — CID 114835563
3-N-(3-bromo-5-chloro-2-pyridinyl)benzene-1,3-diamine (PubChem CID 114835563) has the molecular formula C11H9BrClN3 and a molecular weight of 298.57 g/mol. Its IUPAC name is 3-N-(3-bromo-5-chloro-2-pyridinyl)benzene-1,3-diamine.
| Compound Name | 3-N-(3-bromo-5-chloro-2-pyridinyl)benzene-1,3-diamine |
|---|---|
| PubChem CID | 114835563 |
| Molecular Formula | C11H9BrClN3 |
| Molecular Weight | 298.57 g/mol |
| Exact Mass | 296.97 |
| IUPAC Name | 3-N-(3-bromo-5-chloro-2-pyridinyl)benzene-1,3-diamine |
| SMILES | Nc1cccc(Nc2ncc(Cl)cc2Br)c1 |
| InChI | InChI=1S/C11H9BrClN3/c12-10-4-7(13)6-15-11(10)16-9-3-1-2-8(14)5-9/h1-6H,14H2,(H,15,16) |
| InChIKey | YITBIQWFBOCHSM-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.57 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|