C14H9BrClN3O2 — CID 114836563
5-[(3-bromo-5-chloro-2-pyridinyl)amino]-2-methylisoindole-1,3-dione (PubChem CID 114836563) has the molecular formula C14H9BrClN3O2 and a molecular weight of 366.60 g/mol. Its IUPAC name is 5-[(3-bromo-5-chloro-2-pyridinyl)amino]-2-methylisoindole-1,3-dione.
| Compound Name | 5-[(3-bromo-5-chloro-2-pyridinyl)amino]-2-methylisoindole-1,3-dione |
|---|---|
| PubChem CID | 114836563 |
| Molecular Formula | C14H9BrClN3O2 |
| Molecular Weight | 366.60 g/mol |
| Exact Mass | 364.96 |
| IUPAC Name | 5-[(3-bromo-5-chloro-2-pyridinyl)amino]-2-methylisoindole-1,3-dione |
| SMILES | CN1C(=O)c2ccc(Nc3ncc(Cl)cc3Br)cc2C1=O |
| InChI | InChI=1S/C14H9BrClN3O2/c1-19-13(20)9-3-2-8(5-10(9)14(19)21)18-12-11(15)4-7(16)6-17-12/h2-6H,1H3,(H,17,18) |
| InChIKey | YXVOCCISJJDVPI-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.60 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|