C20H36O2 — CID 11483665
(2E,4E)-icosa-2,4-dienoic acid (PubChem CID 11483665) has the molecular formula C20H36O2 and a molecular weight of 308.51 g/mol. Its IUPAC name is (2E,4E)-icosa-2,4-dienoic acid.
| Compound Name | (2E,4E)-icosa-2,4-dienoic acid |
|---|---|
| PubChem CID | 11483665 |
| Molecular Formula | C20H36O2 |
| Molecular Weight | 308.51 g/mol |
| Exact Mass | 308.27 |
| IUPAC Name | (2E,4E)-icosa-2,4-dienoic acid |
| SMILES | CCCCCCCCCCCCCCC/C=C/C=C/C(=O)O |
| InChI | InChI=1S/C20H36O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20(21)22/h16-19H,2-15H2,1H3,(H,21,22)/b17-16+,19-18+ |
| InChIKey | LNAVIIOBBICBIS-NBRVCOCJSA-N |
| XLogP | 6.66 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.51 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|