C12H16BrClN2O — CID 114836813
3-bromo-5-chloro-N-ethyl-N-(oxolan-2-ylmethyl)pyridin-2-amine (PubChem CID 114836813) has the molecular formula C12H16BrClN2O and a molecular weight of 319.63 g/mol. Its IUPAC name is 3-bromo-5-chloro-N-ethyl-N-(oxolan-2-ylmethyl)pyridin-2-amine.
| Compound Name | 3-bromo-5-chloro-N-ethyl-N-(oxolan-2-ylmethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 114836813 |
| Molecular Formula | C12H16BrClN2O |
| Molecular Weight | 319.63 g/mol |
| Exact Mass | 318.01 |
| IUPAC Name | 3-bromo-5-chloro-N-ethyl-N-(oxolan-2-ylmethyl)pyridin-2-amine |
| SMILES | CCN(CC1CCCO1)c1ncc(Cl)cc1Br |
| InChI | InChI=1S/C12H16BrClN2O/c1-2-16(8-10-4-3-5-17-10)12-11(13)6-9(14)7-15-12/h6-7,10H,2-5,8H2,1H3 |
| InChIKey | JDNYRFYCDQAFJH-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.63 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |