C13H18BrClN2 — CID 114836828
3-bromo-5-chloro-N-(cyclohexylmethyl)-N-methylpyridin-2-amine (PubChem CID 114836828) has the molecular formula C13H18BrClN2 and a molecular weight of 317.66 g/mol. Its IUPAC name is 3-bromo-5-chloro-N-(cyclohexylmethyl)-N-methylpyridin-2-amine.
| Compound Name | 3-bromo-5-chloro-N-(cyclohexylmethyl)-N-methylpyridin-2-amine |
|---|---|
| PubChem CID | 114836828 |
| Molecular Formula | C13H18BrClN2 |
| Molecular Weight | 317.66 g/mol |
| Exact Mass | 316.03 |
| IUPAC Name | 3-bromo-5-chloro-N-(cyclohexylmethyl)-N-methylpyridin-2-amine |
| SMILES | CN(CC1CCCCC1)c1ncc(Cl)cc1Br |
| InChI | InChI=1S/C13H18BrClN2/c1-17(9-10-5-3-2-4-6-10)13-12(14)7-11(15)8-16-13/h7-8,10H,2-6,9H2,1H3 |
| InChIKey | ACHQVZVPPPUZCR-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.66 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |