C20H22O3 — CID 11483722
(6S,6aR,9S,10aS)-6-(4-hydroxyphenyl)-9-methyl-6a,7,8,9,10,10a-hexahydro-6H-benzo[c]chromen-2-ol (PubChem CID 11483722) has the molecular formula C20H22O3 and a molecular weight of 310.39 g/mol. Its IUPAC name is (6S,6aR,9S,10aS)-6-(4-hydroxyphenyl)-9-methyl-6a,7,8,9,10,10a-hexahydro-6H-benzo[c]chromen-2-ol.
| Compound Name | (6S,6aR,9S,10aS)-6-(4-hydroxyphenyl)-9-methyl-6a,7,8,9,10,10a-hexahydro-6H-benzo[c]chromen-2-ol |
|---|---|
| PubChem CID | 11483722 |
| Molecular Formula | C20H22O3 |
| Molecular Weight | 310.39 g/mol |
| Exact Mass | 310.16 |
| IUPAC Name | (6S,6aR,9S,10aS)-6-(4-hydroxyphenyl)-9-methyl-6a,7,8,9,10,10a-hexahydro-6H-benzo[c]chromen-2-ol |
| SMILES | C[C@H]1CC[C@@H]2[C@H](C1)c1cc(O)ccc1O[C@@H]2c1ccc(O)cc1 |
| InChI | InChI=1S/C20H22O3/c1-12-2-8-16-17(10-12)18-11-15(22)7-9-19(18)23-20(16)13-3-5-14(21)6-4-13/h3-7,9,11-12,16-17,20-22H,2,8,10H2,1H3/t12-,16+,17-,20+/m0/s1 |
| InChIKey | AQAFFHYYMQXHHQ-TXYQZCGRSA-N |
| XLogP | 4.75 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.39 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |