About 4-[2,4-dioxo-6-(trifluoromethyl)-1H-pyrimidin-3-yl]-5-fluoro-2-methylbenzonitrile
4-[2,4-dioxo-6-(trifluoromethyl)-1H-pyrimidin-3-yl]-5-fluoro-2-methylbenzonitrile (PubChem CID 11483794) has the molecular formula C13H7F4N3O2
and a molecular weight of 313.21 g/mol. Its IUPAC name is 4-[2,4-dioxo-6-(trifluoromethyl)-1H-pyrimidin-3-yl]-5-fluoro-2-methylbenzonitrile.
Molecular Properties
| Compound Name | 4-[2,4-dioxo-6-(trifluoromethyl)-1H-pyrimidin-3-yl]-5-fluoro-2-methylbenzonitrile |
| PubChem CID | 11483794 |
| Molecular Formula | C13H7F4N3O2 |
| Molecular Weight | 313.21 g/mol |
| Exact Mass | 313.05 |
| IUPAC Name | 4-[2,4-dioxo-6-(trifluoromethyl)-1H-pyrimidin-3-yl]-5-fluoro-2-methylbenzonitrile |
| SMILES | Cc1cc(-n2c(=O)cc(C(F)(F)F)[nH]c2=O)c(F)cc1C#N |
| InChI | InChI=1S/C13H7F4N3O2/c1-6-2-9(8(14)3-7(6)5-18)20-11(21)4-10(13(15,16)17)19-12(20)22/h2-4H,1H3,(H,19,22) |
| InChIKey | QLLGEXKWHISCMW-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 78.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.21 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[2,4-dioxo-6-(trifluoromethyl)-1H-pyrimidin-3-yl]-5-fluoro-2-methylbenzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2,4-dioxo-6-(trifluoromethyl)-1H-pyrimidin-3-yl]-5-fluoro-2-methylbenzonitrile?
The IUPAC name of 4-[2,4-dioxo-6-(trifluoromethyl)-1H-pyrimidin-3-yl]-5-fluoro-2-methylbenzonitrile (CID 11483794) is 4-[2,4-dioxo-6-(trifluoromethyl)-1H-pyrimidin-3-yl]-5-fluoro-2-methylbenzonitrile.
What is the SMILES notation for 4-[2,4-dioxo-6-(trifluoromethyl)-1H-pyrimidin-3-yl]-5-fluoro-2-methylbenzonitrile?
The canonical SMILES for 4-[2,4-dioxo-6-(trifluoromethyl)-1H-pyrimidin-3-yl]-5-fluoro-2-methylbenzonitrile is Cc1cc(-n2c(=O)cc(C(F)(F)F)[nH]c2=O)c(F)cc1C#N.
What is the InChIKey of 4-[2,4-dioxo-6-(trifluoromethyl)-1H-pyrimidin-3-yl]-5-fluoro-2-methylbenzonitrile?
The InChIKey is QLLGEXKWHISCMW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H7F4N3O2/c1-6-2-9(8(14)3-7(6)5-18)20-11(21)4-10(13(15,16)17)19-12(20)22/h2-4H,1H3,(H,19,22).
What are the key properties of 4-[2,4-dioxo-6-(trifluoromethyl)-1H-pyrimidin-3-yl]-5-fluoro-2-methylbenzonitrile?
4-[2,4-dioxo-6-(trifluoromethyl)-1H-pyrimidin-3-yl]-5-fluoro-2-methylbenzonitrile has a molecular weight of 313.21 g/mol, XLogP of 1.86, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2,4-dioxo-6-(trifluoromethyl)-1H-pyrimidin-3-yl]-5-fluoro-2-methylbenzonitrile is sourced from PubChem (CID 11483794), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).