C11H17F3N2O3S — CID 11483840
(2S,3aS,7aS)-1-methyl-N-(trifluoromethylsulfonyl)-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxamide (PubChem CID 11483840) has the molecular formula C11H17F3N2O3S and a molecular weight of 314.33 g/mol. Its IUPAC name is (2S,3aS,7aS)-1-methyl-N-(trifluoromethylsulfonyl)-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxamide.
| Compound Name | (2S,3aS,7aS)-1-methyl-N-(trifluoromethylsulfonyl)-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxamide |
|---|---|
| PubChem CID | 11483840 |
| Molecular Formula | C11H17F3N2O3S |
| Molecular Weight | 314.33 g/mol |
| Exact Mass | 314.09 |
| IUPAC Name | (2S,3aS,7aS)-1-methyl-N-(trifluoromethylsulfonyl)-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxamide |
| SMILES | CN1[C@H](C(=O)NS(=O)(=O)C(F)(F)F)C[C@@H]2CCCC[C@@H]21 |
| InChI | InChI=1S/C11H17F3N2O3S/c1-16-8-5-3-2-4-7(8)6-9(16)10(17)15-20(18,19)11(12,13)14/h7-9H,2-6H2,1H3,(H,15,17)/t7-,8-,9-/m0/s1 |
| InChIKey | JDRNSDFBNQDTDL-CIUDSAMLSA-N |
| XLogP | 1.22 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.33 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |