C11H15BrCl2N2 — CID 114838487
3-bromo-5-chloro-N-(1-chloro-4-methylpentan-2-yl)pyridin-2-amine (PubChem CID 114838487) has the molecular formula C11H15BrCl2N2 and a molecular weight of 326.07 g/mol. Its IUPAC name is 3-bromo-5-chloro-N-(1-chloro-4-methylpentan-2-yl)pyridin-2-amine.
| Compound Name | 3-bromo-5-chloro-N-(1-chloro-4-methylpentan-2-yl)pyridin-2-amine |
|---|---|
| PubChem CID | 114838487 |
| Molecular Formula | C11H15BrCl2N2 |
| Molecular Weight | 326.07 g/mol |
| Exact Mass | 323.98 |
| IUPAC Name | 3-bromo-5-chloro-N-(1-chloro-4-methylpentan-2-yl)pyridin-2-amine |
| SMILES | CC(C)CC(CCl)Nc1ncc(Cl)cc1Br |
| InChI | InChI=1S/C11H15BrCl2N2/c1-7(2)3-9(5-13)16-11-10(12)4-8(14)6-15-11/h4,6-7,9H,3,5H2,1-2H3,(H,15,16) |
| InChIKey | HSLIUHUDUBXCGZ-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.07 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|