C19H26O4 — CID 11483975
methyl (15S,16S)-15,16-dihydroxyoctadeca-6,9,12-triynoate (PubChem CID 11483975) has the molecular formula C19H26O4 and a molecular weight of 318.41 g/mol. Its IUPAC name is methyl (15S,16S)-15,16-dihydroxyoctadeca-6,9,12-triynoate.
| Compound Name | methyl (15S,16S)-15,16-dihydroxyoctadeca-6,9,12-triynoate |
|---|---|
| PubChem CID | 11483975 |
| Molecular Formula | C19H26O4 |
| Molecular Weight | 318.41 g/mol |
| Exact Mass | 318.18 |
| IUPAC Name | methyl (15S,16S)-15,16-dihydroxyoctadeca-6,9,12-triynoate |
| SMILES | CC[C@H](O)[C@@H](O)CC#CCC#CCC#CCCCCC(=O)OC |
| InChI | InChI=1S/C19H26O4/c1-3-17(20)18(21)15-13-11-9-7-5-4-6-8-10-12-14-16-19(22)23-2/h17-18,20-21H,3-4,9-10,12,14-16H2,1-2H3/t17-,18-/m0/s1 |
| InChIKey | XGGOTPCSJBODMF-ROUUACIJSA-N |
| XLogP | 2.03 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.41 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|