C17H21NO3S — CID 11484018
4-methyl-N-[[(1R,5S)-5-methyl-4-oxocyclopent-2-en-1-yl]methyl]-N-prop-2-enylbenzenesulfonamide (PubChem CID 11484018) has the molecular formula C17H21NO3S and a molecular weight of 319.43 g/mol. Its IUPAC name is 4-methyl-N-[[(1R,5S)-5-methyl-4-oxocyclopent-2-en-1-yl]methyl]-N-prop-2-enylbenzenesulfonamide.
| Compound Name | 4-methyl-N-[[(1R,5S)-5-methyl-4-oxocyclopent-2-en-1-yl]methyl]-N-prop-2-enylbenzenesulfonamide |
|---|---|
| PubChem CID | 11484018 |
| Molecular Formula | C17H21NO3S |
| Molecular Weight | 319.43 g/mol |
| Exact Mass | 319.12 |
| IUPAC Name | 4-methyl-N-[[(1R,5S)-5-methyl-4-oxocyclopent-2-en-1-yl]methyl]-N-prop-2-enylbenzenesulfonamide |
| SMILES | C=CCN(C[C@@H]1C=CC(=O)[C@H]1C)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C17H21NO3S/c1-4-11-18(12-15-7-10-17(19)14(15)3)22(20,21)16-8-5-13(2)6-9-16/h4-10,14-15H,1,11-12H2,2-3H3/t14-,15-/m0/s1 |
| InChIKey | GOIWTFJQJBJZHS-GJZGRUSLSA-N |
| XLogP | 2.56 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.43 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|