C15H22ClFN2 — CID 114842325
N-[(4-chloro-2-fluorophenyl)methyl]-2-methyl-3-pyrrolidin-1-ylpropan-1-amine (PubChem CID 114842325) has the molecular formula C15H22ClFN2 and a molecular weight of 284.81 g/mol. Its IUPAC name is N-[(4-chloro-2-fluorophenyl)methyl]-2-methyl-3-pyrrolidin-1-ylpropan-1-amine.
| Compound Name | N-[(4-chloro-2-fluorophenyl)methyl]-2-methyl-3-pyrrolidin-1-ylpropan-1-amine |
|---|---|
| PubChem CID | 114842325 |
| Molecular Formula | C15H22ClFN2 |
| Molecular Weight | 284.81 g/mol |
| Exact Mass | 284.15 |
| IUPAC Name | N-[(4-chloro-2-fluorophenyl)methyl]-2-methyl-3-pyrrolidin-1-ylpropan-1-amine |
| SMILES | CC(CNCc1ccc(Cl)cc1F)CN1CCCC1 |
| InChI | InChI=1S/C15H22ClFN2/c1-12(11-19-6-2-3-7-19)9-18-10-13-4-5-14(16)8-15(13)17/h4-5,8,12,18H,2-3,6-7,9-11H2,1H3 |
| InChIKey | KQMCGUQBUIGPDL-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.81 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |