C22H34O2 — CID 11484329
(1R,2S,5R,10S,13S,14S,17R,19R)-17-hydroxy-14-methylpentacyclo[11.8.0.02,10.05,10.014,19]henicosan-7-one (PubChem CID 11484329) has the molecular formula C22H34O2 and a molecular weight of 330.51 g/mol. Its IUPAC name is (1R,2S,5R,10S,13S,14S,17R,19R)-17-hydroxy-14-methylpentacyclo[11.8.0.02,10.05,10.014,19]henicosan-7-one.
| Compound Name | (1R,2S,5R,10S,13S,14S,17R,19R)-17-hydroxy-14-methylpentacyclo[11.8.0.02,10.05,10.014,19]henicosan-7-one |
|---|---|
| PubChem CID | 11484329 |
| Molecular Formula | C22H34O2 |
| Molecular Weight | 330.51 g/mol |
| Exact Mass | 330.26 |
| IUPAC Name | (1R,2S,5R,10S,13S,14S,17R,19R)-17-hydroxy-14-methylpentacyclo[11.8.0.02,10.05,10.014,19]henicosan-7-one |
| SMILES | C[C@]12CC[C@@H](O)C[C@H]1CC[C@@H]1[C@@H]2CC[C@]23CCC(=O)C[C@H]2CC[C@@H]13 |
| InChI | InChI=1S/C22H34O2/c1-21-9-6-16(23)12-14(21)2-4-18-19(21)8-11-22-10-7-17(24)13-15(22)3-5-20(18)22/h14-16,18-20,23H,2-13H2,1H3/t14-,15-,16-,18-,19+,20+,21+,22-/m1/s1 |
| InChIKey | VBMBLOHWTJOZMT-ZKVBVRCCSA-N |
| XLogP | 4.74 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.51 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |