C18H23NO5 — CID 11484396
benzyl (2S,3S)-2-[(E)-4-acetyloxybut-1-enyl]-3-hydroxypyrrolidine-1-carboxylate (PubChem CID 11484396) has the molecular formula C18H23NO5 and a molecular weight of 333.38 g/mol. Its IUPAC name is benzyl (2S,3S)-2-[(E)-4-acetyloxybut-1-enyl]-3-hydroxypyrrolidine-1-carboxylate.
| Compound Name | benzyl (2S,3S)-2-[(E)-4-acetyloxybut-1-enyl]-3-hydroxypyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 11484396 |
| Molecular Formula | C18H23NO5 |
| Molecular Weight | 333.38 g/mol |
| Exact Mass | 333.16 |
| IUPAC Name | benzyl (2S,3S)-2-[(E)-4-acetyloxybut-1-enyl]-3-hydroxypyrrolidine-1-carboxylate |
| SMILES | CC(=O)OCC/C=C/[C@H]1[C@@H](O)CCN1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C18H23NO5/c1-14(20)23-12-6-5-9-16-17(21)10-11-19(16)18(22)24-13-15-7-3-2-4-8-15/h2-5,7-9,16-17,21H,6,10-13H2,1H3/b9-5+/t16-,17-/m0/s1 |
| InChIKey | ZZNOUBSIYPCFKC-ZTXDWSKGSA-N |
| XLogP | 2.27 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.38 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|