C17H9F5O2 — CID 11484572
2,3,3,3-tetrafluoro-2-(6-fluorophenanthren-1-yl)propanoic acid (PubChem CID 11484572) has the molecular formula C17H9F5O2 and a molecular weight of 340.25 g/mol. Its IUPAC name is 2,3,3,3-tetrafluoro-2-(6-fluorophenanthren-1-yl)propanoic acid.
| Compound Name | 2,3,3,3-tetrafluoro-2-(6-fluorophenanthren-1-yl)propanoic acid |
|---|---|
| PubChem CID | 11484572 |
| Molecular Formula | C17H9F5O2 |
| Molecular Weight | 340.25 g/mol |
| Exact Mass | 340.05 |
| IUPAC Name | 2,3,3,3-tetrafluoro-2-(6-fluorophenanthren-1-yl)propanoic acid |
| SMILES | O=C(O)C(F)(c1cccc2c1ccc1ccc(F)cc12)C(F)(F)F |
| InChI | InChI=1S/C17H9F5O2/c18-10-6-4-9-5-7-12-11(13(9)8-10)2-1-3-14(12)16(19,15(23)24)17(20,21)22/h1-8H,(H,23,24) |
| InChIKey | GQALODRSKLWWOS-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.25 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|