C17H20N6O2 — CID 11484581
4-(1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridin-6-yl)-6-(4-nitrophenyl)pyrimidin-2-amine (PubChem CID 11484581) has the molecular formula C17H20N6O2 and a molecular weight of 340.39 g/mol. Its IUPAC name is 4-(1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridin-6-yl)-6-(4-nitrophenyl)pyrimidin-2-amine.
| Compound Name | 4-(1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridin-6-yl)-6-(4-nitrophenyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 11484581 |
| Molecular Formula | C17H20N6O2 |
| Molecular Weight | 340.39 g/mol |
| Exact Mass | 340.16 |
| IUPAC Name | 4-(1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridin-6-yl)-6-(4-nitrophenyl)pyrimidin-2-amine |
| SMILES | Nc1nc(-c2ccc([N+](=O)[O-])cc2)cc(N2CC3CCCNC3C2)n1 |
| InChI | InChI=1S/C17H20N6O2/c18-17-20-14(11-3-5-13(6-4-11)23(24)25)8-16(21-17)22-9-12-2-1-7-19-15(12)10-22/h3-6,8,12,15,19H,1-2,7,9-10H2,(H2,18,20,21) |
| InChIKey | MHQAQJXFTAHVSY-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 110.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.39 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|