C23H22N2O — CID 11484654
10,10-dimethyl-4-(2-methylphenyl)-11-oxa-3,5-diazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(17),2(6),4,7(12),13,15-hexaene (PubChem CID 11484654) has the molecular formula C23H22N2O and a molecular weight of 342.44 g/mol. Its IUPAC name is 10,10-dimethyl-4-(2-methylphenyl)-11-oxa-3,5-diazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(17),2(6),4,7(12),13,15-hexaene.
| Compound Name | 10,10-dimethyl-4-(2-methylphenyl)-11-oxa-3,5-diazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(17),2(6),4,7(12),13,15-hexaene |
|---|---|
| PubChem CID | 11484654 |
| Molecular Formula | C23H22N2O |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.17 |
| IUPAC Name | 10,10-dimethyl-4-(2-methylphenyl)-11-oxa-3,5-diazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(17),2(6),4,7(12),13,15-hexaene |
| SMILES | Cc1ccccc1-c1nc2c3c(c4ccccc4c2[nH]1)OC(C)(C)CC3 |
| InChI | InChI=1S/C23H22N2O/c1-14-8-4-5-9-15(14)22-24-19-16-10-6-7-11-17(16)21-18(20(19)25-22)12-13-23(2,3)26-21/h4-11H,12-13H2,1-3H3,(H,24,25) |
| InChIKey | VURBCFFCSJVFQK-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |