C15H21Cl2N — CID 114846776
1-[5-chloro-2-(chloromethyl)phenyl]-3,3-diethylpyrrolidine (PubChem CID 114846776) has the molecular formula C15H21Cl2N and a molecular weight of 286.25 g/mol. Its IUPAC name is 1-[5-chloro-2-(chloromethyl)phenyl]-3,3-diethylpyrrolidine.
| Compound Name | 1-[5-chloro-2-(chloromethyl)phenyl]-3,3-diethylpyrrolidine |
|---|---|
| PubChem CID | 114846776 |
| Molecular Formula | C15H21Cl2N |
| Molecular Weight | 286.25 g/mol |
| Exact Mass | 285.11 |
| IUPAC Name | 1-[5-chloro-2-(chloromethyl)phenyl]-3,3-diethylpyrrolidine |
| SMILES | CCC1(CC)CCN(c2cc(Cl)ccc2CCl)C1 |
| InChI | InChI=1S/C15H21Cl2N/c1-3-15(4-2)7-8-18(11-15)14-9-13(17)6-5-12(14)10-16/h5-6,9H,3-4,7-8,10-11H2,1-2H3 |
| InChIKey | XGSAFSNURIFCIQ-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.25 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|