C16H23Cl2N — CID 114846780
5-chloro-2-(chloromethyl)-N-(4,4-dimethylcyclohexyl)-N-methylaniline (PubChem CID 114846780) has the molecular formula C16H23Cl2N and a molecular weight of 300.27 g/mol. Its IUPAC name is 5-chloro-2-(chloromethyl)-N-(4,4-dimethylcyclohexyl)-N-methylaniline.
| Compound Name | 5-chloro-2-(chloromethyl)-N-(4,4-dimethylcyclohexyl)-N-methylaniline |
|---|---|
| PubChem CID | 114846780 |
| Molecular Formula | C16H23Cl2N |
| Molecular Weight | 300.27 g/mol |
| Exact Mass | 299.12 |
| IUPAC Name | 5-chloro-2-(chloromethyl)-N-(4,4-dimethylcyclohexyl)-N-methylaniline |
| SMILES | CN(c1cc(Cl)ccc1CCl)C1CCC(C)(C)CC1 |
| InChI | InChI=1S/C16H23Cl2N/c1-16(2)8-6-14(7-9-16)19(3)15-10-13(18)5-4-12(15)11-17/h4-5,10,14H,6-9,11H2,1-3H3 |
| InChIKey | PTLBHBYEPBTABL-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.27 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|