C17H29NO6 — CID 11484684
ethyl (E,6R,7S)-6-acetyloxy-7-[(2-methylpropan-2-yl)oxycarbonylamino]oct-2-enoate (PubChem CID 11484684) has the molecular formula C17H29NO6 and a molecular weight of 343.42 g/mol. Its IUPAC name is ethyl (E,6R,7S)-6-acetyloxy-7-[(2-methylpropan-2-yl)oxycarbonylamino]oct-2-enoate.
| Compound Name | ethyl (E,6R,7S)-6-acetyloxy-7-[(2-methylpropan-2-yl)oxycarbonylamino]oct-2-enoate |
|---|---|
| PubChem CID | 11484684 |
| Molecular Formula | C17H29NO6 |
| Molecular Weight | 343.42 g/mol |
| Exact Mass | 343.20 |
| IUPAC Name | ethyl (E,6R,7S)-6-acetyloxy-7-[(2-methylpropan-2-yl)oxycarbonylamino]oct-2-enoate |
| SMILES | CCOC(=O)/C=C/CC[C@@H](OC(C)=O)[C@H](C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H29NO6/c1-7-22-15(20)11-9-8-10-14(23-13(3)19)12(2)18-16(21)24-17(4,5)6/h9,11-12,14H,7-8,10H2,1-6H3,(H,18,21)/b11-9+/t12-,14+/m0/s1 |
| InChIKey | ADTXOZDZCRKQOR-KVLWQBRYSA-N |
| XLogP | 2.73 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.42 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|