C21H29NO3 — CID 11484689
methyl (2E)-2-[(3S,8aR)-8a-pentyl-3-phenyl-3,6,7,8-tetrahydro-2H-[1,3]oxazolo[3,2-a]pyridin-5-ylidene]acetate (PubChem CID 11484689) has the molecular formula C21H29NO3 and a molecular weight of 343.47 g/mol. Its IUPAC name is methyl (2E)-2-[(3S,8aR)-8a-pentyl-3-phenyl-3,6,7,8-tetrahydro-2H-[1,3]oxazolo[3,2-a]pyridin-5-ylidene]acetate.
| Compound Name | methyl (2E)-2-[(3S,8aR)-8a-pentyl-3-phenyl-3,6,7,8-tetrahydro-2H-[1,3]oxazolo[3,2-a]pyridin-5-ylidene]acetate |
|---|---|
| PubChem CID | 11484689 |
| Molecular Formula | C21H29NO3 |
| Molecular Weight | 343.47 g/mol |
| Exact Mass | 343.21 |
| IUPAC Name | methyl (2E)-2-[(3S,8aR)-8a-pentyl-3-phenyl-3,6,7,8-tetrahydro-2H-[1,3]oxazolo[3,2-a]pyridin-5-ylidene]acetate |
| SMILES | CCCCC[C@@]12CCC/C(=C\C(=O)OC)N1[C@@H](c1ccccc1)CO2 |
| InChI | InChI=1S/C21H29NO3/c1-3-4-8-13-21-14-9-12-18(15-20(23)24-2)22(21)19(16-25-21)17-10-6-5-7-11-17/h5-7,10-11,15,19H,3-4,8-9,12-14,16H2,1-2H3/b18-15+/t19-,21-/m1/s1 |
| InChIKey | BNNGUQKMBYRISX-ADRMNIKQSA-N |
| XLogP | 4.58 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.47 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|