About (1R)-N-benzyl-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-phenylsulfanylethanamine
(1R)-N-benzyl-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-phenylsulfanylethanamine (PubChem CID 11484690) has the molecular formula C20H25NO2S
and a molecular weight of 343.49 g/mol. Its IUPAC name is (1R)-N-benzyl-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-phenylsulfanylethanamine.
Molecular Properties
| Compound Name | (1R)-N-benzyl-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-phenylsulfanylethanamine |
| PubChem CID | 11484690 |
| Molecular Formula | C20H25NO2S |
| Molecular Weight | 343.49 g/mol |
| Exact Mass | 343.16 |
| IUPAC Name | (1R)-N-benzyl-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-phenylsulfanylethanamine |
| SMILES | CC1(C)OC[C@H]([C@H](CSc2ccccc2)NCc2ccccc2)O1 |
| InChI | InChI=1S/C20H25NO2S/c1-20(2)22-14-19(23-20)18(15-24-17-11-7-4-8-12-17)21-13-16-9-5-3-6-10-16/h3-12,18-19,21H,13-15H2,1-2H3/t18-,19+/m0/s1 |
| InChIKey | CBUGKVDQGUMWCU-RBUKOAKNSA-N |
| XLogP | 4.09 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.49 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (1R)-N-benzyl-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-phenylsulfanylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R)-N-benzyl-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-phenylsulfanylethanamine?
The IUPAC name of (1R)-N-benzyl-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-phenylsulfanylethanamine (CID 11484690) is (1R)-N-benzyl-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-phenylsulfanylethanamine.
What is the SMILES notation for (1R)-N-benzyl-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-phenylsulfanylethanamine?
The canonical SMILES for (1R)-N-benzyl-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-phenylsulfanylethanamine is CC1(C)OC[C@H]([C@H](CSc2ccccc2)NCc2ccccc2)O1.
What is the InChIKey of (1R)-N-benzyl-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-phenylsulfanylethanamine?
The InChIKey is CBUGKVDQGUMWCU-RBUKOAKNSA-N. The full InChI is InChI=1S/C20H25NO2S/c1-20(2)22-14-19(23-20)18(15-24-17-11-7-4-8-12-17)21-13-16-9-5-3-6-10-16/h3-12,18-19,21H,13-15H2,1-2H3/t18-,19+/m0/s1.
What are the key properties of (1R)-N-benzyl-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-phenylsulfanylethanamine?
(1R)-N-benzyl-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-phenylsulfanylethanamine has a molecular weight of 343.49 g/mol, XLogP of 4.09, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (1R)-N-benzyl-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-phenylsulfanylethanamine is sourced from PubChem (CID 11484690), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).