C19H27N3O3 — CID 11484758
1-(2-amino-9,10-dimethoxy-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizin-3-yl)pyrrolidin-2-one (PubChem CID 11484758) has the molecular formula C19H27N3O3 and a molecular weight of 345.44 g/mol. Its IUPAC name is 1-(2-amino-9,10-dimethoxy-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizin-3-yl)pyrrolidin-2-one.
| Compound Name | 1-(2-amino-9,10-dimethoxy-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizin-3-yl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 11484758 |
| Molecular Formula | C19H27N3O3 |
| Molecular Weight | 345.44 g/mol |
| Exact Mass | 345.21 |
| IUPAC Name | 1-(2-amino-9,10-dimethoxy-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizin-3-yl)pyrrolidin-2-one |
| SMILES | COc1cc2c(cc1OC)C1CC(N)C(N3CCCC3=O)CN1CC2 |
| InChI | InChI=1S/C19H27N3O3/c1-24-17-8-12-5-7-21-11-16(22-6-3-4-19(22)23)14(20)10-15(21)13(12)9-18(17)25-2/h8-9,14-16H,3-7,10-11,20H2,1-2H3 |
| InChIKey | INWWWTILZXHHJN-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 68.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.44 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |