About 2-benzyl-2-diethoxyphosphoryl-1,3-dithiane
2-benzyl-2-diethoxyphosphoryl-1,3-dithiane (PubChem CID 11484789) has the molecular formula C15H23O3PS2
and a molecular weight of 346.45 g/mol. Its IUPAC name is 2-benzyl-2-diethoxyphosphoryl-1,3-dithiane.
Molecular Properties
| Compound Name | 2-benzyl-2-diethoxyphosphoryl-1,3-dithiane |
| PubChem CID | 11484789 |
| Molecular Formula | C15H23O3PS2 |
| Molecular Weight | 346.45 g/mol |
| Exact Mass | 346.08 |
| IUPAC Name | 2-benzyl-2-diethoxyphosphoryl-1,3-dithiane |
| SMILES | CCOP(=O)(OCC)C1(Cc2ccccc2)SCCCS1 |
| InChI | InChI=1S/C15H23O3PS2/c1-3-17-19(16,18-4-2)15(20-11-8-12-21-15)13-14-9-6-5-7-10-14/h5-7,9-10H,3-4,8,11-13H2,1-2H3 |
| InChIKey | YDRZLQGRJBBRHK-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 346.45 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2-benzyl-2-diethoxyphosphoryl-1,3-dithiane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-benzyl-2-diethoxyphosphoryl-1,3-dithiane?
The IUPAC name of 2-benzyl-2-diethoxyphosphoryl-1,3-dithiane (CID 11484789) is 2-benzyl-2-diethoxyphosphoryl-1,3-dithiane.
What is the SMILES notation for 2-benzyl-2-diethoxyphosphoryl-1,3-dithiane?
The canonical SMILES for 2-benzyl-2-diethoxyphosphoryl-1,3-dithiane is CCOP(=O)(OCC)C1(Cc2ccccc2)SCCCS1.
What is the InChIKey of 2-benzyl-2-diethoxyphosphoryl-1,3-dithiane?
The InChIKey is YDRZLQGRJBBRHK-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H23O3PS2/c1-3-17-19(16,18-4-2)15(20-11-8-12-21-15)13-14-9-6-5-7-10-14/h5-7,9-10H,3-4,8,11-13H2,1-2H3.
What are the key properties of 2-benzyl-2-diethoxyphosphoryl-1,3-dithiane?
2-benzyl-2-diethoxyphosphoryl-1,3-dithiane has a molecular weight of 346.45 g/mol, XLogP of 5.02, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-benzyl-2-diethoxyphosphoryl-1,3-dithiane is sourced from PubChem (CID 11484789), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).